4-(2-methylphenoxy)benzenesulfonyl chloride

C13H11ClO3S — CID 2794712

IUPAC4-(2-methylphenoxy)benzenesulfonyl chloride
SMILESCc1ccccc1Oc1ccc(S(=O)(=O)Cl)cc1
InChIInChI=1S/C13H11ClO3S/c1-10-4-2-3-5-13(10)17-11-6-8-12(9-7-11)18(14,15)16/h2-9H,1H3
InChIKeyIJPKGMOVNZHZKZ-UHFFFAOYSA-N
MW282.75 g/mol
LogP3.71
Rot. Bonds3

About 4-(2-methylphenoxy)benzenesulfonyl chloride

4-(2-methylphenoxy)benzenesulfonyl chloride (PubChem CID 2794712) has the molecular formula C13H11ClO3S and a molecular weight of 282.75 g/mol. Its IUPAC name is 4-(2-methylphenoxy)benzenesulfonyl chloride.

Molecular Properties

Compound Name4-(2-methylphenoxy)benzenesulfonyl chloride
PubChem CID2794712
Molecular FormulaC13H11ClO3S
Molecular Weight282.75 g/mol
Exact Mass282.01
IUPAC Name4-(2-methylphenoxy)benzenesulfonyl chloride
SMILESCc1ccccc1Oc1ccc(S(=O)(=O)Cl)cc1
InChIInChI=1S/C13H11ClO3S/c1-10-4-2-3-5-13(10)17-11-6-8-12(9-7-11)18(14,15)16/h2-9H,1H3
InChIKeyIJPKGMOVNZHZKZ-UHFFFAOYSA-N
XLogP3.71
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.75
LogP ≤ 53.71
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 4-(2-methylphenoxy)benzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2-methylphenoxy)benzenesulfonyl chloride?
The IUPAC name of 4-(2-methylphenoxy)benzenesulfonyl chloride (CID 2794712) is 4-(2-methylphenoxy)benzenesulfonyl chloride.
What is the SMILES notation for 4-(2-methylphenoxy)benzenesulfonyl chloride?
The canonical SMILES for 4-(2-methylphenoxy)benzenesulfonyl chloride is Cc1ccccc1Oc1ccc(S(=O)(=O)Cl)cc1.
What is the InChIKey of 4-(2-methylphenoxy)benzenesulfonyl chloride?
The InChIKey is IJPKGMOVNZHZKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClO3S/c1-10-4-2-3-5-13(10)17-11-6-8-12(9-7-11)18(14,15)16/h2-9H,1H3.
What are the key properties of 4-(2-methylphenoxy)benzenesulfonyl chloride?
4-(2-methylphenoxy)benzenesulfonyl chloride has a molecular weight of 282.75 g/mol, XLogP of 3.71, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylphenoxy)benzenesulfonyl chloride is sourced from PubChem (CID 2794712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).