About [2-(4-chlorophenyl)-1,3-thiazol-4-yl]methanamine;hydrochloride
[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methanamine;hydrochloride (PubChem CID 2794737) has the molecular formula C10H10Cl2N2S
and a molecular weight of 261.18 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-1,3-thiazol-4-yl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [2-(4-chlorophenyl)-1,3-thiazol-4-yl]methanamine;hydrochloride |
| PubChem CID | 2794737 |
| Molecular Formula | C10H10Cl2N2S |
| Molecular Weight | 261.18 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | [2-(4-chlorophenyl)-1,3-thiazol-4-yl]methanamine;hydrochloride |
| SMILES | Cl.NCc1csc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C10H9ClN2S.ClH/c11-8-3-1-7(2-4-8)10-13-9(5-12)6-14-10;/h1-4,6H,5,12H2;1H |
| InChIKey | PNBZPHKDYJHRSP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.18 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(4-chlorophenyl)-1,3-thiazol-4-yl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-chlorophenyl)-1,3-thiazol-4-yl]methanamine;hydrochloride?
The IUPAC name of [2-(4-chlorophenyl)-1,3-thiazol-4-yl]methanamine;hydrochloride (CID 2794737) is [2-(4-chlorophenyl)-1,3-thiazol-4-yl]methanamine;hydrochloride.
What is the SMILES notation for [2-(4-chlorophenyl)-1,3-thiazol-4-yl]methanamine;hydrochloride?
The canonical SMILES for [2-(4-chlorophenyl)-1,3-thiazol-4-yl]methanamine;hydrochloride is Cl.NCc1csc(-c2ccc(Cl)cc2)n1.
What is the InChIKey of [2-(4-chlorophenyl)-1,3-thiazol-4-yl]methanamine;hydrochloride?
The InChIKey is PNBZPHKDYJHRSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClN2S.ClH/c11-8-3-1-7(2-4-8)10-13-9(5-12)6-14-10;/h1-4,6H,5,12H2;1H.
What are the key properties of [2-(4-chlorophenyl)-1,3-thiazol-4-yl]methanamine;hydrochloride?
[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methanamine;hydrochloride has a molecular weight of 261.18 g/mol, XLogP of 3.34, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-chlorophenyl)-1,3-thiazol-4-yl]methanamine;hydrochloride is sourced from PubChem (CID 2794737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).