About methyl 3-(aminomethyl)benzoate;hydrochloride
methyl 3-(aminomethyl)benzoate;hydrochloride (PubChem CID 2794825) has the molecular formula C9H12ClNO2
and a molecular weight of 201.65 g/mol. Its IUPAC name is methyl 3-(aminomethyl)benzoate;hydrochloride.
Molecular Properties
| Compound Name | methyl 3-(aminomethyl)benzoate;hydrochloride |
| PubChem CID | 2794825 |
| Molecular Formula | C9H12ClNO2 |
| Molecular Weight | 201.65 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | methyl 3-(aminomethyl)benzoate;hydrochloride |
| SMILES | COC(=O)c1cccc(CN)c1.Cl |
| InChI | InChI=1S/C9H11NO2.ClH/c1-12-9(11)8-4-2-3-7(5-8)6-10;/h2-5H,6,10H2,1H3;1H |
| InChIKey | UOWRPTFJISFGPI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.65 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 3-(aminomethyl)benzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(aminomethyl)benzoate;hydrochloride?
The IUPAC name of methyl 3-(aminomethyl)benzoate;hydrochloride (CID 2794825) is methyl 3-(aminomethyl)benzoate;hydrochloride.
What is the SMILES notation for methyl 3-(aminomethyl)benzoate;hydrochloride?
The canonical SMILES for methyl 3-(aminomethyl)benzoate;hydrochloride is COC(=O)c1cccc(CN)c1.Cl.
What is the InChIKey of methyl 3-(aminomethyl)benzoate;hydrochloride?
The InChIKey is UOWRPTFJISFGPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2.ClH/c1-12-9(11)8-4-2-3-7(5-8)6-10;/h2-5H,6,10H2,1H3;1H.
What are the key properties of methyl 3-(aminomethyl)benzoate;hydrochloride?
methyl 3-(aminomethyl)benzoate;hydrochloride has a molecular weight of 201.65 g/mol, XLogP of 1.35, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(aminomethyl)benzoate;hydrochloride is sourced from PubChem (CID 2794825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).