About 5-amino-2,6-dimethylpyrazolo[3,4-d]pyrimidin-4-one
5-amino-2,6-dimethylpyrazolo[3,4-d]pyrimidin-4-one (PubChem CID 2794983) has the molecular formula C7H9N5O
and a molecular weight of 179.18 g/mol. Its IUPAC name is 5-amino-2,6-dimethylpyrazolo[3,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-amino-2,6-dimethylpyrazolo[3,4-d]pyrimidin-4-one |
| PubChem CID | 2794983 |
| Molecular Formula | C7H9N5O |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 5-amino-2,6-dimethylpyrazolo[3,4-d]pyrimidin-4-one |
| SMILES | Cc1nc2nn(C)cc2c(=O)n1N |
| InChI | InChI=1S/C7H9N5O/c1-4-9-6-5(3-11(2)10-6)7(13)12(4)8/h3H,8H2,1-2H3 |
| InChIKey | APOYGMVLJHALMJ-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 78.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-amino-2,6-dimethylpyrazolo[3,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2,6-dimethylpyrazolo[3,4-d]pyrimidin-4-one?
The IUPAC name of 5-amino-2,6-dimethylpyrazolo[3,4-d]pyrimidin-4-one (CID 2794983) is 5-amino-2,6-dimethylpyrazolo[3,4-d]pyrimidin-4-one.
What is the SMILES notation for 5-amino-2,6-dimethylpyrazolo[3,4-d]pyrimidin-4-one?
The canonical SMILES for 5-amino-2,6-dimethylpyrazolo[3,4-d]pyrimidin-4-one is Cc1nc2nn(C)cc2c(=O)n1N.
What is the InChIKey of 5-amino-2,6-dimethylpyrazolo[3,4-d]pyrimidin-4-one?
The InChIKey is APOYGMVLJHALMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5O/c1-4-9-6-5(3-11(2)10-6)7(13)12(4)8/h3H,8H2,1-2H3.
What are the key properties of 5-amino-2,6-dimethylpyrazolo[3,4-d]pyrimidin-4-one?
5-amino-2,6-dimethylpyrazolo[3,4-d]pyrimidin-4-one has a molecular weight of 179.18 g/mol, XLogP of -0.85, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2,6-dimethylpyrazolo[3,4-d]pyrimidin-4-one is sourced from PubChem (CID 2794983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).