C11H11Br3O — CID 2795011
(11S)-7,7,11-tribromopentacyclo[6.3.0.02,6.03,10.05,9]undecan-1-ol (PubChem CID 2795011) has the molecular formula C11H11Br3O and a molecular weight of 398.92 g/mol. Its IUPAC name is (11S)-7,7,11-tribromopentacyclo[6.3.0.02,6.03,10.05,9]undecan-1-ol.
| Compound Name | (11S)-7,7,11-tribromopentacyclo[6.3.0.02,6.03,10.05,9]undecan-1-ol |
|---|---|
| PubChem CID | 2795011 |
| Molecular Formula | C11H11Br3O |
| Molecular Weight | 398.92 g/mol |
| Exact Mass | 395.84 |
| IUPAC Name | (11S)-7,7,11-tribromopentacyclo[6.3.0.02,6.03,10.05,9]undecan-1-ol |
| SMILES | OC12C(Br)C3C4CC5C3C1C(Br)(Br)C5C42 |
| InChI | InChI=1S/C11H11Br3O/c12-9-5-3-1-2-4(5)8-10(9,15)6(3)7(2)11(8,13)14/h2-9,15H,1H2 |
| InChIKey | WZBOKYFPZUQGLI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.92 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|