C13H28 — CID 2795065
2,2,4,4,6,6-hexamethylheptane (PubChem CID 2795065) has the molecular formula C13H28 and a molecular weight of 184.37 g/mol. Its IUPAC name is 2,2,4,4,6,6-hexamethylheptane.
| Compound Name | 2,2,4,4,6,6-hexamethylheptane |
|---|---|
| PubChem CID | 2795065 |
| Molecular Formula | C13H28 |
| Molecular Weight | 184.37 g/mol |
| Exact Mass | 184.22 |
| IUPAC Name | 2,2,4,4,6,6-hexamethylheptane |
| SMILES | CC(C)(C)CC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C13H28/c1-11(2,3)9-13(7,8)10-12(4,5)6/h9-10H2,1-8H3 |
| InChIKey | LIMYLTFOQJHNJD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.37 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |