About 3H-isoindol-1-amine;hydrochloride
3H-isoindol-1-amine;hydrochloride (PubChem CID 2795203) has the molecular formula C8H9ClN2
and a molecular weight of 168.63 g/mol. Its IUPAC name is 3H-isoindol-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 3H-isoindol-1-amine;hydrochloride |
| PubChem CID | 2795203 |
| Molecular Formula | C8H9ClN2 |
| Molecular Weight | 168.63 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 3H-isoindol-1-amine;hydrochloride |
| SMILES | Cl.NC1=NCc2ccccc21 |
| InChI | InChI=1S/C8H8N2.ClH/c9-8-7-4-2-1-3-6(7)5-10-8;/h1-4H,5H2,(H2,9,10);1H |
| InChIKey | MRLAJFUGSBSFDH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.63 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3H-isoindol-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-isoindol-1-amine;hydrochloride?
The IUPAC name of 3H-isoindol-1-amine;hydrochloride (CID 2795203) is 3H-isoindol-1-amine;hydrochloride.
What is the SMILES notation for 3H-isoindol-1-amine;hydrochloride?
The canonical SMILES for 3H-isoindol-1-amine;hydrochloride is Cl.NC1=NCc2ccccc21.
What is the InChIKey of 3H-isoindol-1-amine;hydrochloride?
The InChIKey is MRLAJFUGSBSFDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2.ClH/c9-8-7-4-2-1-3-6(7)5-10-8;/h1-4H,5H2,(H2,9,10);1H.
What are the key properties of 3H-isoindol-1-amine;hydrochloride?
3H-isoindol-1-amine;hydrochloride has a molecular weight of 168.63 g/mol, XLogP of 1.33, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-isoindol-1-amine;hydrochloride is sourced from PubChem (CID 2795203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).