About 2-ethylideneadamantane
2-ethylideneadamantane (PubChem CID 2795221) has the molecular formula C12H18
and a molecular weight of 162.28 g/mol. Its IUPAC name is 2-ethylideneadamantane.
Molecular Properties
| Compound Name | 2-ethylideneadamantane |
| PubChem CID | 2795221 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | 2-ethylideneadamantane |
| SMILES | CC=C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C12H18/c1-2-12-10-4-8-3-9(6-10)7-11(12)5-8/h2,8-11H,3-7H2,1H3/b12-2- |
| InChIKey | DDSATBSDGAPDPM-OIXVIMQBSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylideneadamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylideneadamantane?
The IUPAC name of 2-ethylideneadamantane (CID 2795221) is 2-ethylideneadamantane.
What is the SMILES notation for 2-ethylideneadamantane?
The canonical SMILES for 2-ethylideneadamantane is CC=C1C2CC3CC(C2)CC1C3.
What is the InChIKey of 2-ethylideneadamantane?
The InChIKey is DDSATBSDGAPDPM-OIXVIMQBSA-N. The full InChI is InChI=1S/C12H18/c1-2-12-10-4-8-3-9(6-10)7-11(12)5-8/h2,8-11H,3-7H2,1H3/b12-2-.
What are the key properties of 2-ethylideneadamantane?
2-ethylideneadamantane has a molecular weight of 162.28 g/mol, XLogP of 3.39, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylideneadamantane is sourced from PubChem (CID 2795221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).