About 2-butylpropane-1,3-diol
2-butylpropane-1,3-diol (PubChem CID 2795259) has the molecular formula C7H16O2
and a molecular weight of 132.20 g/mol. Its IUPAC name is 2-butylpropane-1,3-diol.
Molecular Properties
| Compound Name | 2-butylpropane-1,3-diol |
| PubChem CID | 2795259 |
| Molecular Formula | C7H16O2 |
| Molecular Weight | 132.20 g/mol |
| Exact Mass | 132.12 |
| IUPAC Name | 2-butylpropane-1,3-diol |
| SMILES | CCCCC(CO)CO |
| InChI | InChI=1S/C7H16O2/c1-2-3-4-7(5-8)6-9/h7-9H,2-6H2,1H3 |
| InChIKey | SIMYRXPCIUXDGR-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.20 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butylpropane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylpropane-1,3-diol?
The IUPAC name of 2-butylpropane-1,3-diol (CID 2795259) is 2-butylpropane-1,3-diol.
What is the SMILES notation for 2-butylpropane-1,3-diol?
The canonical SMILES for 2-butylpropane-1,3-diol is CCCCC(CO)CO.
What is the InChIKey of 2-butylpropane-1,3-diol?
The InChIKey is SIMYRXPCIUXDGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O2/c1-2-3-4-7(5-8)6-9/h7-9H,2-6H2,1H3.
What are the key properties of 2-butylpropane-1,3-diol?
2-butylpropane-1,3-diol has a molecular weight of 132.20 g/mol, XLogP of 0.78, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylpropane-1,3-diol is sourced from PubChem (CID 2795259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).