About 2-morpholin-4-ylphenol
2-morpholin-4-ylphenol (PubChem CID 2795394) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is 2-morpholin-4-ylphenol.
Molecular Properties
| Compound Name | 2-morpholin-4-ylphenol |
| PubChem CID | 2795394 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 2-morpholin-4-ylphenol |
| SMILES | Oc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C10H13NO2/c12-10-4-2-1-3-9(10)11-5-7-13-8-6-11/h1-4,12H,5-8H2 |
| InChIKey | VMPYFWTYGZZUMY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-morpholin-4-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylphenol?
The IUPAC name of 2-morpholin-4-ylphenol (CID 2795394) is 2-morpholin-4-ylphenol.
What is the SMILES notation for 2-morpholin-4-ylphenol?
The canonical SMILES for 2-morpholin-4-ylphenol is Oc1ccccc1N1CCOCC1.
What is the InChIKey of 2-morpholin-4-ylphenol?
The InChIKey is VMPYFWTYGZZUMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c12-10-4-2-1-3-9(10)11-5-7-13-8-6-11/h1-4,12H,5-8H2.
What are the key properties of 2-morpholin-4-ylphenol?
2-morpholin-4-ylphenol has a molecular weight of 179.22 g/mol, XLogP of 1.23, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylphenol is sourced from PubChem (CID 2795394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).