About 2-imidazol-1-ylbenzoic acid
2-imidazol-1-ylbenzoic acid (PubChem CID 2795545) has the molecular formula C10H8N2O2
and a molecular weight of 188.19 g/mol. Its IUPAC name is 2-imidazol-1-ylbenzoic acid.
Molecular Properties
| Compound Name | 2-imidazol-1-ylbenzoic acid |
| PubChem CID | 2795545 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 2-imidazol-1-ylbenzoic acid |
| SMILES | O=C(O)c1ccccc1-n1ccnc1 |
| InChI | InChI=1S/C10H8N2O2/c13-10(14)8-3-1-2-4-9(8)12-6-5-11-7-12/h1-7H,(H,13,14) |
| InChIKey | JLUJWVALPVZBOU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-imidazol-1-ylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imidazol-1-ylbenzoic acid?
The IUPAC name of 2-imidazol-1-ylbenzoic acid (CID 2795545) is 2-imidazol-1-ylbenzoic acid.
What is the SMILES notation for 2-imidazol-1-ylbenzoic acid?
The canonical SMILES for 2-imidazol-1-ylbenzoic acid is O=C(O)c1ccccc1-n1ccnc1.
What is the InChIKey of 2-imidazol-1-ylbenzoic acid?
The InChIKey is JLUJWVALPVZBOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2/c13-10(14)8-3-1-2-4-9(8)12-6-5-11-7-12/h1-7H,(H,13,14).
What are the key properties of 2-imidazol-1-ylbenzoic acid?
2-imidazol-1-ylbenzoic acid has a molecular weight of 188.19 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imidazol-1-ylbenzoic acid is sourced from PubChem (CID 2795545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).