About 3-piperidin-1-ylbenzoic acid
3-piperidin-1-ylbenzoic acid (PubChem CID 2795552) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is 3-piperidin-1-ylbenzoic acid.
Molecular Properties
| Compound Name | 3-piperidin-1-ylbenzoic acid |
| PubChem CID | 2795552 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 3-piperidin-1-ylbenzoic acid |
| SMILES | O=C(O)c1cccc(N2CCCCC2)c1 |
| InChI | InChI=1S/C12H15NO2/c14-12(15)10-5-4-6-11(9-10)13-7-2-1-3-8-13/h4-6,9H,1-3,7-8H2,(H,14,15) |
| InChIKey | FLQRORYAJSTYLT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-piperidin-1-ylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-piperidin-1-ylbenzoic acid?
The IUPAC name of 3-piperidin-1-ylbenzoic acid (CID 2795552) is 3-piperidin-1-ylbenzoic acid.
What is the SMILES notation for 3-piperidin-1-ylbenzoic acid?
The canonical SMILES for 3-piperidin-1-ylbenzoic acid is O=C(O)c1cccc(N2CCCCC2)c1.
What is the InChIKey of 3-piperidin-1-ylbenzoic acid?
The InChIKey is FLQRORYAJSTYLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c14-12(15)10-5-4-6-11(9-10)13-7-2-1-3-8-13/h4-6,9H,1-3,7-8H2,(H,14,15).
What are the key properties of 3-piperidin-1-ylbenzoic acid?
3-piperidin-1-ylbenzoic acid has a molecular weight of 205.26 g/mol, XLogP of 2.38, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperidin-1-ylbenzoic acid is sourced from PubChem (CID 2795552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).