C16H15NO3S3 — CID 2795743
(2,4-dimethylphenyl) 5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-sulfonate (PubChem CID 2795743) has the molecular formula C16H15NO3S3 and a molecular weight of 365.50 g/mol. Its IUPAC name is (2,4-dimethylphenyl) 5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-sulfonate.
| Compound Name | (2,4-dimethylphenyl) 5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-sulfonate |
|---|---|
| PubChem CID | 2795743 |
| Molecular Formula | C16H15NO3S3 |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | (2,4-dimethylphenyl) 5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-sulfonate |
| SMILES | Cc1ccc(OS(=O)(=O)c2ccc(-c3csc(C)n3)s2)c(C)c1 |
| InChI | InChI=1S/C16H15NO3S3/c1-10-4-5-14(11(2)8-10)20-23(18,19)16-7-6-15(22-16)13-9-21-12(3)17-13/h4-9H,1-3H3 |
| InChIKey | JCOXQIKANZNKGY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|