About 2-phenyl-4-thiophen-2-yl-1,3-thiazole
2-phenyl-4-thiophen-2-yl-1,3-thiazole (PubChem CID 2795747) has the molecular formula C13H9NS2
and a molecular weight of 243.36 g/mol. Its IUPAC name is 2-phenyl-4-thiophen-2-yl-1,3-thiazole.
Molecular Properties
| Compound Name | 2-phenyl-4-thiophen-2-yl-1,3-thiazole |
| PubChem CID | 2795747 |
| Molecular Formula | C13H9NS2 |
| Molecular Weight | 243.36 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | 2-phenyl-4-thiophen-2-yl-1,3-thiazole |
| SMILES | c1ccc(-c2nc(-c3cccs3)cs2)cc1 |
| InChI | InChI=1S/C13H9NS2/c1-2-5-10(6-3-1)13-14-11(9-16-13)12-7-4-8-15-12/h1-9H |
| InChIKey | GSMJPRNOHKQEAG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenyl-4-thiophen-2-yl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-4-thiophen-2-yl-1,3-thiazole?
The IUPAC name of 2-phenyl-4-thiophen-2-yl-1,3-thiazole (CID 2795747) is 2-phenyl-4-thiophen-2-yl-1,3-thiazole.
What is the SMILES notation for 2-phenyl-4-thiophen-2-yl-1,3-thiazole?
The canonical SMILES for 2-phenyl-4-thiophen-2-yl-1,3-thiazole is c1ccc(-c2nc(-c3cccs3)cs2)cc1.
What is the InChIKey of 2-phenyl-4-thiophen-2-yl-1,3-thiazole?
The InChIKey is GSMJPRNOHKQEAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NS2/c1-2-5-10(6-3-1)13-14-11(9-16-13)12-7-4-8-15-12/h1-9H.
What are the key properties of 2-phenyl-4-thiophen-2-yl-1,3-thiazole?
2-phenyl-4-thiophen-2-yl-1,3-thiazole has a molecular weight of 243.36 g/mol, XLogP of 4.54, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-4-thiophen-2-yl-1,3-thiazole is sourced from PubChem (CID 2795747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).