About 1-(3-nitro-2-pyridinyl)-1,4-diazepane
1-(3-nitro-2-pyridinyl)-1,4-diazepane (PubChem CID 2795752) has the molecular formula C10H14N4O2
and a molecular weight of 222.25 g/mol. Its IUPAC name is 1-(3-nitro-2-pyridinyl)-1,4-diazepane.
Molecular Properties
| Compound Name | 1-(3-nitro-2-pyridinyl)-1,4-diazepane |
| PubChem CID | 2795752 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 1-(3-nitro-2-pyridinyl)-1,4-diazepane |
| SMILES | O=[N+]([O-])c1cccnc1N1CCCNCC1 |
| InChI | InChI=1S/C10H14N4O2/c15-14(16)9-3-1-5-12-10(9)13-7-2-4-11-6-8-13/h1,3,5,11H,2,4,6-8H2 |
| InChIKey | VBFOCWZEZQRKLP-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-nitro-2-pyridinyl)-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-nitro-2-pyridinyl)-1,4-diazepane?
The IUPAC name of 1-(3-nitro-2-pyridinyl)-1,4-diazepane (CID 2795752) is 1-(3-nitro-2-pyridinyl)-1,4-diazepane.
What is the SMILES notation for 1-(3-nitro-2-pyridinyl)-1,4-diazepane?
The canonical SMILES for 1-(3-nitro-2-pyridinyl)-1,4-diazepane is O=[N+]([O-])c1cccnc1N1CCCNCC1.
What is the InChIKey of 1-(3-nitro-2-pyridinyl)-1,4-diazepane?
The InChIKey is VBFOCWZEZQRKLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O2/c15-14(16)9-3-1-5-12-10(9)13-7-2-4-11-6-8-13/h1,3,5,11H,2,4,6-8H2.
What are the key properties of 1-(3-nitro-2-pyridinyl)-1,4-diazepane?
1-(3-nitro-2-pyridinyl)-1,4-diazepane has a molecular weight of 222.25 g/mol, XLogP of 0.79, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-nitro-2-pyridinyl)-1,4-diazepane is sourced from PubChem (CID 2795752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).