About 3-(2,4-dichlorophenyl)-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile
3-(2,4-dichlorophenyl)-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile (PubChem CID 2795836) has the molecular formula C16H8Cl2F3N
and a molecular weight of 342.15 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile.
Molecular Properties
| Compound Name | 3-(2,4-dichlorophenyl)-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile |
| PubChem CID | 2795836 |
| Molecular Formula | C16H8Cl2F3N |
| Molecular Weight | 342.15 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(Cl)cc1Cl)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H8Cl2F3N/c17-14-5-4-11(15(18)8-14)6-12(9-22)10-2-1-3-13(7-10)16(19,20)21/h1-8H |
| InChIKey | DWEZSONLCJQOTM-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.15 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,4-dichlorophenyl)-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-dichlorophenyl)-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile?
The IUPAC name of 3-(2,4-dichlorophenyl)-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile (CID 2795836) is 3-(2,4-dichlorophenyl)-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile.
What is the SMILES notation for 3-(2,4-dichlorophenyl)-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile?
The canonical SMILES for 3-(2,4-dichlorophenyl)-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile is N#CC(=Cc1ccc(Cl)cc1Cl)c1cccc(C(F)(F)F)c1.
What is the InChIKey of 3-(2,4-dichlorophenyl)-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile?
The InChIKey is DWEZSONLCJQOTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8Cl2F3N/c17-14-5-4-11(15(18)8-14)6-12(9-22)10-2-1-3-13(7-10)16(19,20)21/h1-8H.
What are the key properties of 3-(2,4-dichlorophenyl)-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile?
3-(2,4-dichlorophenyl)-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile has a molecular weight of 342.15 g/mol, XLogP of 6.08, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dichlorophenyl)-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile is sourced from PubChem (CID 2795836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).