About 3-O-ethyl 5-O-methyl 2-(2-methoxy-2-oxoethyl)sulfanyl-6-methylpyridine-3,5-dicarboxylate
3-O-ethyl 5-O-methyl 2-(2-methoxy-2-oxoethyl)sulfanyl-6-methylpyridine-3,5-dicarboxylate (PubChem CID 2795906) has the molecular formula C14H17NO6S
and a molecular weight of 327.36 g/mol. Its IUPAC name is 3-O-ethyl 5-O-methyl 2-(2-methoxy-2-oxoethyl)sulfanyl-6-methylpyridine-3,5-dicarboxylate.
Molecular Properties
| Compound Name | 3-O-ethyl 5-O-methyl 2-(2-methoxy-2-oxoethyl)sulfanyl-6-methylpyridine-3,5-dicarboxylate |
| PubChem CID | 2795906 |
| Molecular Formula | C14H17NO6S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 3-O-ethyl 5-O-methyl 2-(2-methoxy-2-oxoethyl)sulfanyl-6-methylpyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)OC)c(C)nc1SCC(=O)OC |
| InChI | InChI=1S/C14H17NO6S/c1-5-21-14(18)10-6-9(13(17)20-4)8(2)15-12(10)22-7-11(16)19-3/h6H,5,7H2,1-4H3 |
| InChIKey | MMZFTZKKTMXQND-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze 3-O-ethyl 5-O-methyl 2-(2-methoxy-2-oxoethyl)sulfanyl-6-methylpyridine-3,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-ethyl 5-O-methyl 2-(2-methoxy-2-oxoethyl)sulfanyl-6-methylpyridine-3,5-dicarboxylate?
The IUPAC name of 3-O-ethyl 5-O-methyl 2-(2-methoxy-2-oxoethyl)sulfanyl-6-methylpyridine-3,5-dicarboxylate (CID 2795906) is 3-O-ethyl 5-O-methyl 2-(2-methoxy-2-oxoethyl)sulfanyl-6-methylpyridine-3,5-dicarboxylate.
What is the SMILES notation for 3-O-ethyl 5-O-methyl 2-(2-methoxy-2-oxoethyl)sulfanyl-6-methylpyridine-3,5-dicarboxylate?
The canonical SMILES for 3-O-ethyl 5-O-methyl 2-(2-methoxy-2-oxoethyl)sulfanyl-6-methylpyridine-3,5-dicarboxylate is CCOC(=O)c1cc(C(=O)OC)c(C)nc1SCC(=O)OC.
What is the InChIKey of 3-O-ethyl 5-O-methyl 2-(2-methoxy-2-oxoethyl)sulfanyl-6-methylpyridine-3,5-dicarboxylate?
The InChIKey is MMZFTZKKTMXQND-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO6S/c1-5-21-14(18)10-6-9(13(17)20-4)8(2)15-12(10)22-7-11(16)19-3/h6H,5,7H2,1-4H3.
What are the key properties of 3-O-ethyl 5-O-methyl 2-(2-methoxy-2-oxoethyl)sulfanyl-6-methylpyridine-3,5-dicarboxylate?
3-O-ethyl 5-O-methyl 2-(2-methoxy-2-oxoethyl)sulfanyl-6-methylpyridine-3,5-dicarboxylate has a molecular weight of 327.36 g/mol, XLogP of 1.62, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-ethyl 5-O-methyl 2-(2-methoxy-2-oxoethyl)sulfanyl-6-methylpyridine-3,5-dicarboxylate is sourced from PubChem (CID 2795906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).