C11H13F3N4O3S — CID 2795920
2-[2-oxo-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethylamino]ethyl]sulfanylacetic acid (PubChem CID 2795920) has the molecular formula C11H13F3N4O3S and a molecular weight of 338.31 g/mol. Its IUPAC name is 2-[2-oxo-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethylamino]ethyl]sulfanylacetic acid.
| Compound Name | 2-[2-oxo-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethylamino]ethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 2795920 |
| Molecular Formula | C11H13F3N4O3S |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 2-[2-oxo-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethylamino]ethyl]sulfanylacetic acid |
| SMILES | O=C(O)CSCC(=O)NCCNc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H13F3N4O3S/c12-11(13,14)7-1-2-16-10(18-7)17-4-3-15-8(19)5-22-6-9(20)21/h1-2H,3-6H2,(H,15,19)(H,20,21)(H,16,17,18) |
| InChIKey | FJLAYBCKGVFHHE-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|