About 5-acetyl-2,6-dimethylpyridine-3-carbonitrile
5-acetyl-2,6-dimethylpyridine-3-carbonitrile (PubChem CID 2795948) has the molecular formula C10H10N2O
and a molecular weight of 174.20 g/mol. Its IUPAC name is 5-acetyl-2,6-dimethylpyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 5-acetyl-2,6-dimethylpyridine-3-carbonitrile |
| PubChem CID | 2795948 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 5-acetyl-2,6-dimethylpyridine-3-carbonitrile |
| SMILES | CC(=O)c1cc(C#N)c(C)nc1C |
| InChI | InChI=1S/C10H10N2O/c1-6-9(5-11)4-10(8(3)13)7(2)12-6/h4H,1-3H3 |
| InChIKey | ABAJJIVQPQJWNO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-acetyl-2,6-dimethylpyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-2,6-dimethylpyridine-3-carbonitrile?
The IUPAC name of 5-acetyl-2,6-dimethylpyridine-3-carbonitrile (CID 2795948) is 5-acetyl-2,6-dimethylpyridine-3-carbonitrile.
What is the SMILES notation for 5-acetyl-2,6-dimethylpyridine-3-carbonitrile?
The canonical SMILES for 5-acetyl-2,6-dimethylpyridine-3-carbonitrile is CC(=O)c1cc(C#N)c(C)nc1C.
What is the InChIKey of 5-acetyl-2,6-dimethylpyridine-3-carbonitrile?
The InChIKey is ABAJJIVQPQJWNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O/c1-6-9(5-11)4-10(8(3)13)7(2)12-6/h4H,1-3H3.
What are the key properties of 5-acetyl-2,6-dimethylpyridine-3-carbonitrile?
5-acetyl-2,6-dimethylpyridine-3-carbonitrile has a molecular weight of 174.20 g/mol, XLogP of 1.77, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-2,6-dimethylpyridine-3-carbonitrile is sourced from PubChem (CID 2795948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).