About [4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)-1,4-diazepan-1-yl]-thiophen-2-ylmethanone
[4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)-1,4-diazepan-1-yl]-thiophen-2-ylmethanone (PubChem CID 2796307) has the molecular formula C22H20N4OS2
and a molecular weight of 420.56 g/mol. Its IUPAC name is [4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)-1,4-diazepan-1-yl]-thiophen-2-ylmethanone.
Molecular Properties
| Compound Name | [4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)-1,4-diazepan-1-yl]-thiophen-2-ylmethanone |
| PubChem CID | 2796307 |
| Molecular Formula | C22H20N4OS2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | [4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)-1,4-diazepan-1-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CCCN(c2ncnc3scc(-c4ccccc4)c23)CC1 |
| InChI | InChI=1S/C22H20N4OS2/c27-22(18-8-4-13-28-18)26-10-5-9-25(11-12-26)20-19-17(16-6-2-1-3-7-16)14-29-21(19)24-15-23-20/h1-4,6-8,13-15H,5,9-12H2 |
| InChIKey | UYBXSKMNTSZFBK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)-1,4-diazepan-1-yl]-thiophen-2-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)-1,4-diazepan-1-yl]-thiophen-2-ylmethanone?
The IUPAC name of [4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)-1,4-diazepan-1-yl]-thiophen-2-ylmethanone (CID 2796307) is [4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)-1,4-diazepan-1-yl]-thiophen-2-ylmethanone.
What is the SMILES notation for [4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)-1,4-diazepan-1-yl]-thiophen-2-ylmethanone?
The canonical SMILES for [4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)-1,4-diazepan-1-yl]-thiophen-2-ylmethanone is O=C(c1cccs1)N1CCCN(c2ncnc3scc(-c4ccccc4)c23)CC1.
What is the InChIKey of [4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)-1,4-diazepan-1-yl]-thiophen-2-ylmethanone?
The InChIKey is UYBXSKMNTSZFBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N4OS2/c27-22(18-8-4-13-28-18)26-10-5-9-25(11-12-26)20-19-17(16-6-2-1-3-7-16)14-29-21(19)24-15-23-20/h1-4,6-8,13-15H,5,9-12H2.
What are the key properties of [4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)-1,4-diazepan-1-yl]-thiophen-2-ylmethanone?
[4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)-1,4-diazepan-1-yl]-thiophen-2-ylmethanone has a molecular weight of 420.56 g/mol, XLogP of 4.77, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)-1,4-diazepan-1-yl]-thiophen-2-ylmethanone is sourced from PubChem (CID 2796307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).