About 6-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]chromen-2-one
6-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]chromen-2-one (PubChem CID 2796493) has the molecular formula C16H9Cl2NO3
and a molecular weight of 334.16 g/mol. Its IUPAC name is 6-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]chromen-2-one.
Molecular Properties
| Compound Name | 6-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]chromen-2-one |
| PubChem CID | 2796493 |
| Molecular Formula | C16H9Cl2NO3 |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 6-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]chromen-2-one |
| SMILES | O=c1ccc2cc(/N=C/c3cc(Cl)cc(Cl)c3O)ccc2o1 |
| InChI | InChI=1S/C16H9Cl2NO3/c17-11-5-10(16(21)13(18)7-11)8-19-12-2-3-14-9(6-12)1-4-15(20)22-14/h1-8,21H/b19-8+ |
| InChIKey | ANJQOSPWFQMOAJ-UFWORHAWSA-N |
| XLogP | 4.56 |
| TPSA | 62.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]chromen-2-one?
The IUPAC name of 6-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]chromen-2-one (CID 2796493) is 6-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]chromen-2-one.
What is the SMILES notation for 6-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]chromen-2-one?
The canonical SMILES for 6-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]chromen-2-one is O=c1ccc2cc(/N=C/c3cc(Cl)cc(Cl)c3O)ccc2o1.
What is the InChIKey of 6-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]chromen-2-one?
The InChIKey is ANJQOSPWFQMOAJ-UFWORHAWSA-N. The full InChI is InChI=1S/C16H9Cl2NO3/c17-11-5-10(16(21)13(18)7-11)8-19-12-2-3-14-9(6-12)1-4-15(20)22-14/h1-8,21H/b19-8+.
What are the key properties of 6-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]chromen-2-one?
6-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]chromen-2-one has a molecular weight of 334.16 g/mol, XLogP of 4.56, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]chromen-2-one is sourced from PubChem (CID 2796493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).