About 2-(4-fluorophenyl)-1,2-dihydroimidazo[1,2-a]quinoline;hydrobromide
2-(4-fluorophenyl)-1,2-dihydroimidazo[1,2-a]quinoline;hydrobromide (PubChem CID 2797094) has the molecular formula C17H14BrFN2
and a molecular weight of 345.22 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1,2-dihydroimidazo[1,2-a]quinoline;hydrobromide.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)-1,2-dihydroimidazo[1,2-a]quinoline;hydrobromide |
| PubChem CID | 2797094 |
| Molecular Formula | C17H14BrFN2 |
| Molecular Weight | 345.22 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 2-(4-fluorophenyl)-1,2-dihydroimidazo[1,2-a]quinoline;hydrobromide |
| SMILES | Br.Fc1ccc(C2CN3C(=N2)C=Cc2ccccc23)cc1 |
| InChI | InChI=1S/C17H13FN2.BrH/c18-14-8-5-12(6-9-14)15-11-20-16-4-2-1-3-13(16)7-10-17(20)19-15;/h1-10,15H,11H2;1H |
| InChIKey | LHBHDHIRPCTOSI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.22 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-fluorophenyl)-1,2-dihydroimidazo[1,2-a]quinoline;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)-1,2-dihydroimidazo[1,2-a]quinoline;hydrobromide?
The IUPAC name of 2-(4-fluorophenyl)-1,2-dihydroimidazo[1,2-a]quinoline;hydrobromide (CID 2797094) is 2-(4-fluorophenyl)-1,2-dihydroimidazo[1,2-a]quinoline;hydrobromide.
What is the SMILES notation for 2-(4-fluorophenyl)-1,2-dihydroimidazo[1,2-a]quinoline;hydrobromide?
The canonical SMILES for 2-(4-fluorophenyl)-1,2-dihydroimidazo[1,2-a]quinoline;hydrobromide is Br.Fc1ccc(C2CN3C(=N2)C=Cc2ccccc23)cc1.
What is the InChIKey of 2-(4-fluorophenyl)-1,2-dihydroimidazo[1,2-a]quinoline;hydrobromide?
The InChIKey is LHBHDHIRPCTOSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13FN2.BrH/c18-14-8-5-12(6-9-14)15-11-20-16-4-2-1-3-13(16)7-10-17(20)19-15;/h1-10,15H,11H2;1H.
What are the key properties of 2-(4-fluorophenyl)-1,2-dihydroimidazo[1,2-a]quinoline;hydrobromide?
2-(4-fluorophenyl)-1,2-dihydroimidazo[1,2-a]quinoline;hydrobromide has a molecular weight of 345.22 g/mol, XLogP of 4.39, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)-1,2-dihydroimidazo[1,2-a]quinoline;hydrobromide is sourced from PubChem (CID 2797094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).