About 6-bromo-2-methyl-3,1-benzoxazin-4-one
6-bromo-2-methyl-3,1-benzoxazin-4-one (PubChem CID 2797142) has the molecular formula C9H6BrNO2
and a molecular weight of 240.06 g/mol. Its IUPAC name is 6-bromo-2-methyl-3,1-benzoxazin-4-one.
Molecular Properties
| Compound Name | 6-bromo-2-methyl-3,1-benzoxazin-4-one |
| PubChem CID | 2797142 |
| Molecular Formula | C9H6BrNO2 |
| Molecular Weight | 240.06 g/mol |
| Exact Mass | 238.96 |
| IUPAC Name | 6-bromo-2-methyl-3,1-benzoxazin-4-one |
| SMILES | Cc1nc2ccc(Br)cc2c(=O)o1 |
| InChI | InChI=1S/C9H6BrNO2/c1-5-11-8-3-2-6(10)4-7(8)9(12)13-5/h2-4H,1H3 |
| InChIKey | JCRULBKTDUOWMP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.06 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-2-methyl-3,1-benzoxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-methyl-3,1-benzoxazin-4-one?
The IUPAC name of 6-bromo-2-methyl-3,1-benzoxazin-4-one (CID 2797142) is 6-bromo-2-methyl-3,1-benzoxazin-4-one.
What is the SMILES notation for 6-bromo-2-methyl-3,1-benzoxazin-4-one?
The canonical SMILES for 6-bromo-2-methyl-3,1-benzoxazin-4-one is Cc1nc2ccc(Br)cc2c(=O)o1.
What is the InChIKey of 6-bromo-2-methyl-3,1-benzoxazin-4-one?
The InChIKey is JCRULBKTDUOWMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrNO2/c1-5-11-8-3-2-6(10)4-7(8)9(12)13-5/h2-4H,1H3.
What are the key properties of 6-bromo-2-methyl-3,1-benzoxazin-4-one?
6-bromo-2-methyl-3,1-benzoxazin-4-one has a molecular weight of 240.06 g/mol, XLogP of 2.26, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-methyl-3,1-benzoxazin-4-one is sourced from PubChem (CID 2797142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).