C17H15ClN4O4S2 — CID 2797277
4-(3-chlorophenyl)-3-[(2,5-dimethoxy-4-nitrophenyl)sulfanylmethyl]-1H-1,2,4-triazole-5-thione (PubChem CID 2797277) has the molecular formula C17H15ClN4O4S2 and a molecular weight of 438.92 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-3-[(2,5-dimethoxy-4-nitrophenyl)sulfanylmethyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(3-chlorophenyl)-3-[(2,5-dimethoxy-4-nitrophenyl)sulfanylmethyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 2797277 |
| Molecular Formula | C17H15ClN4O4S2 |
| Molecular Weight | 438.92 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | 4-(3-chlorophenyl)-3-[(2,5-dimethoxy-4-nitrophenyl)sulfanylmethyl]-1H-1,2,4-triazole-5-thione |
| SMILES | COc1cc([N+](=O)[O-])c(OC)cc1SCc1n[nH]c(=S)n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H15ClN4O4S2/c1-25-13-8-15(14(26-2)7-12(13)22(23)24)28-9-16-19-20-17(27)21(16)11-5-3-4-10(18)6-11/h3-8H,9H2,1-2H3,(H,20,27) |
| InChIKey | GTGAEXDSNFKESK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 95.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.92 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|