About S-[2-(2,6-dimethylanilino)-2-oxoethyl] 3-chloro-1-benzothiophene-2-carbothioate
S-[2-(2,6-dimethylanilino)-2-oxoethyl] 3-chloro-1-benzothiophene-2-carbothioate (PubChem CID 2797531) has the molecular formula C19H16ClNO2S2
and a molecular weight of 389.93 g/mol. Its IUPAC name is S-[2-(2,6-dimethylanilino)-2-oxoethyl] 3-chloro-1-benzothiophene-2-carbothioate.
Molecular Properties
| Compound Name | S-[2-(2,6-dimethylanilino)-2-oxoethyl] 3-chloro-1-benzothiophene-2-carbothioate |
| PubChem CID | 2797531 |
| Molecular Formula | C19H16ClNO2S2 |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | S-[2-(2,6-dimethylanilino)-2-oxoethyl] 3-chloro-1-benzothiophene-2-carbothioate |
| SMILES | Cc1cccc(C)c1NC(=O)CSC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C19H16ClNO2S2/c1-11-6-5-7-12(2)17(11)21-15(22)10-24-19(23)18-16(20)13-8-3-4-9-14(13)25-18/h3-9H,10H2,1-2H3,(H,21,22) |
| InChIKey | DWPJIYMYPPIBDP-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[2-(2,6-dimethylanilino)-2-oxoethyl] 3-chloro-1-benzothiophene-2-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[2-(2,6-dimethylanilino)-2-oxoethyl] 3-chloro-1-benzothiophene-2-carbothioate?
The IUPAC name of S-[2-(2,6-dimethylanilino)-2-oxoethyl] 3-chloro-1-benzothiophene-2-carbothioate (CID 2797531) is S-[2-(2,6-dimethylanilino)-2-oxoethyl] 3-chloro-1-benzothiophene-2-carbothioate.
What is the SMILES notation for S-[2-(2,6-dimethylanilino)-2-oxoethyl] 3-chloro-1-benzothiophene-2-carbothioate?
The canonical SMILES for S-[2-(2,6-dimethylanilino)-2-oxoethyl] 3-chloro-1-benzothiophene-2-carbothioate is Cc1cccc(C)c1NC(=O)CSC(=O)c1sc2ccccc2c1Cl.
What is the InChIKey of S-[2-(2,6-dimethylanilino)-2-oxoethyl] 3-chloro-1-benzothiophene-2-carbothioate?
The InChIKey is DWPJIYMYPPIBDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16ClNO2S2/c1-11-6-5-7-12(2)17(11)21-15(22)10-24-19(23)18-16(20)13-8-3-4-9-14(13)25-18/h3-9H,10H2,1-2H3,(H,21,22).
What are the key properties of S-[2-(2,6-dimethylanilino)-2-oxoethyl] 3-chloro-1-benzothiophene-2-carbothioate?
S-[2-(2,6-dimethylanilino)-2-oxoethyl] 3-chloro-1-benzothiophene-2-carbothioate has a molecular weight of 389.93 g/mol, XLogP of 5.68, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-[2-(2,6-dimethylanilino)-2-oxoethyl] 3-chloro-1-benzothiophene-2-carbothioate is sourced from PubChem (CID 2797531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).