About (4-chlorophenyl)-(5,7-dichloro-3-methyl-1-benzofuran-2-yl)methanone
(4-chlorophenyl)-(5,7-dichloro-3-methyl-1-benzofuran-2-yl)methanone (PubChem CID 2797713) has the molecular formula C16H9Cl3O2
and a molecular weight of 339.61 g/mol. Its IUPAC name is (4-chlorophenyl)-(5,7-dichloro-3-methyl-1-benzofuran-2-yl)methanone.
Molecular Properties
| Compound Name | (4-chlorophenyl)-(5,7-dichloro-3-methyl-1-benzofuran-2-yl)methanone |
| PubChem CID | 2797713 |
| Molecular Formula | C16H9Cl3O2 |
| Molecular Weight | 339.61 g/mol |
| Exact Mass | 337.97 |
| IUPAC Name | (4-chlorophenyl)-(5,7-dichloro-3-methyl-1-benzofuran-2-yl)methanone |
| SMILES | Cc1c(C(=O)c2ccc(Cl)cc2)oc2c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C16H9Cl3O2/c1-8-12-6-11(18)7-13(19)16(12)21-15(8)14(20)9-2-4-10(17)5-3-9/h2-7H,1H3 |
| InChIKey | HXKSKTVLUAVGHJ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.61 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-chlorophenyl)-(5,7-dichloro-3-methyl-1-benzofuran-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)-(5,7-dichloro-3-methyl-1-benzofuran-2-yl)methanone?
The IUPAC name of (4-chlorophenyl)-(5,7-dichloro-3-methyl-1-benzofuran-2-yl)methanone (CID 2797713) is (4-chlorophenyl)-(5,7-dichloro-3-methyl-1-benzofuran-2-yl)methanone.
What is the SMILES notation for (4-chlorophenyl)-(5,7-dichloro-3-methyl-1-benzofuran-2-yl)methanone?
The canonical SMILES for (4-chlorophenyl)-(5,7-dichloro-3-methyl-1-benzofuran-2-yl)methanone is Cc1c(C(=O)c2ccc(Cl)cc2)oc2c(Cl)cc(Cl)cc12.
What is the InChIKey of (4-chlorophenyl)-(5,7-dichloro-3-methyl-1-benzofuran-2-yl)methanone?
The InChIKey is HXKSKTVLUAVGHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9Cl3O2/c1-8-12-6-11(18)7-13(19)16(12)21-15(8)14(20)9-2-4-10(17)5-3-9/h2-7H,1H3.
What are the key properties of (4-chlorophenyl)-(5,7-dichloro-3-methyl-1-benzofuran-2-yl)methanone?
(4-chlorophenyl)-(5,7-dichloro-3-methyl-1-benzofuran-2-yl)methanone has a molecular weight of 339.61 g/mol, XLogP of 5.93, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)-(5,7-dichloro-3-methyl-1-benzofuran-2-yl)methanone is sourced from PubChem (CID 2797713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).