About 2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]aniline
2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 2797831) has the molecular formula C14H10N4O3
and a molecular weight of 282.26 g/mol. Its IUPAC name is 2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]aniline.
Molecular Properties
| Compound Name | 2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]aniline |
| PubChem CID | 2797831 |
| Molecular Formula | C14H10N4O3 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | Nc1ccccc1-c1nc(-c2cccc([N+](=O)[O-])c2)no1 |
| InChI | InChI=1S/C14H10N4O3/c15-12-7-2-1-6-11(12)14-16-13(17-21-14)9-4-3-5-10(8-9)18(19)20/h1-8H,15H2 |
| InChIKey | KMHGXADXXCWKHX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]aniline?
The IUPAC name of 2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]aniline (CID 2797831) is 2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]aniline.
What is the SMILES notation for 2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]aniline?
The canonical SMILES for 2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]aniline is Nc1ccccc1-c1nc(-c2cccc([N+](=O)[O-])c2)no1.
What is the InChIKey of 2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]aniline?
The InChIKey is KMHGXADXXCWKHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N4O3/c15-12-7-2-1-6-11(12)14-16-13(17-21-14)9-4-3-5-10(8-9)18(19)20/h1-8H,15H2.
What are the key properties of 2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]aniline?
2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]aniline has a molecular weight of 282.26 g/mol, XLogP of 2.89, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]aniline is sourced from PubChem (CID 2797831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).