About (2,4-difluorophenyl)-(3,5-dimethyl-1H-pyrazol-4-yl)diazene
(2,4-difluorophenyl)-(3,5-dimethyl-1H-pyrazol-4-yl)diazene (PubChem CID 2797919) has the molecular formula C11H10F2N4
and a molecular weight of 236.22 g/mol. Its IUPAC name is (2,4-difluorophenyl)-(3,5-dimethyl-1H-pyrazol-4-yl)diazene.
Molecular Properties
| Compound Name | (2,4-difluorophenyl)-(3,5-dimethyl-1H-pyrazol-4-yl)diazene |
| PubChem CID | 2797919 |
| Molecular Formula | C11H10F2N4 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | (2,4-difluorophenyl)-(3,5-dimethyl-1H-pyrazol-4-yl)diazene |
| SMILES | Cc1n[nH]c(C)c1/N=N/c1ccc(F)cc1F |
| InChI | InChI=1S/C11H10F2N4/c1-6-11(7(2)15-14-6)17-16-10-4-3-8(12)5-9(10)13/h3-5H,1-2H3,(H,14,15)/b17-16+ |
| InChIKey | ZQRHPDOOYYTCTO-WUKNDPDISA-N |
| XLogP | 3.72 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze (2,4-difluorophenyl)-(3,5-dimethyl-1H-pyrazol-4-yl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-difluorophenyl)-(3,5-dimethyl-1H-pyrazol-4-yl)diazene?
The IUPAC name of (2,4-difluorophenyl)-(3,5-dimethyl-1H-pyrazol-4-yl)diazene (CID 2797919) is (2,4-difluorophenyl)-(3,5-dimethyl-1H-pyrazol-4-yl)diazene.
What is the SMILES notation for (2,4-difluorophenyl)-(3,5-dimethyl-1H-pyrazol-4-yl)diazene?
The canonical SMILES for (2,4-difluorophenyl)-(3,5-dimethyl-1H-pyrazol-4-yl)diazene is Cc1n[nH]c(C)c1/N=N/c1ccc(F)cc1F.
What is the InChIKey of (2,4-difluorophenyl)-(3,5-dimethyl-1H-pyrazol-4-yl)diazene?
The InChIKey is ZQRHPDOOYYTCTO-WUKNDPDISA-N. The full InChI is InChI=1S/C11H10F2N4/c1-6-11(7(2)15-14-6)17-16-10-4-3-8(12)5-9(10)13/h3-5H,1-2H3,(H,14,15)/b17-16+.
What are the key properties of (2,4-difluorophenyl)-(3,5-dimethyl-1H-pyrazol-4-yl)diazene?
(2,4-difluorophenyl)-(3,5-dimethyl-1H-pyrazol-4-yl)diazene has a molecular weight of 236.22 g/mol, XLogP of 3.72, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-difluorophenyl)-(3,5-dimethyl-1H-pyrazol-4-yl)diazene is sourced from PubChem (CID 2797919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).