C10H16IN3S2 — CID 2797925
6-ethylsulfanyl-3-(thiophen-2-ylmethyl)-2,4-dihydro-1H-1,3,5-triazine;hydroiodide (PubChem CID 2797925) has the molecular formula C10H16IN3S2 and a molecular weight of 369.30 g/mol. Its IUPAC name is 6-ethylsulfanyl-3-(thiophen-2-ylmethyl)-2,4-dihydro-1H-1,3,5-triazine;hydroiodide.
| Compound Name | 6-ethylsulfanyl-3-(thiophen-2-ylmethyl)-2,4-dihydro-1H-1,3,5-triazine;hydroiodide |
|---|---|
| PubChem CID | 2797925 |
| Molecular Formula | C10H16IN3S2 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 368.98 |
| IUPAC Name | 6-ethylsulfanyl-3-(thiophen-2-ylmethyl)-2,4-dihydro-1H-1,3,5-triazine;hydroiodide |
| SMILES | CCSC1=NCN(Cc2cccs2)CN1.I |
| InChI | InChI=1S/C10H15N3S2.HI/c1-2-14-10-11-7-13(8-12-10)6-9-4-3-5-15-9;/h3-5H,2,6-8H2,1H3,(H,11,12);1H |
| InChIKey | YSEZPDZBPFETQK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|