About 1-(4-bromo-1H-pyrrol-2-yl)-2,2,2-trichloroethanone
1-(4-bromo-1H-pyrrol-2-yl)-2,2,2-trichloroethanone (PubChem CID 2798140) has the molecular formula C6H3BrCl3NO
and a molecular weight of 291.36 g/mol. Its IUPAC name is 1-(4-bromo-1H-pyrrol-2-yl)-2,2,2-trichloroethanone.
Molecular Properties
| Compound Name | 1-(4-bromo-1H-pyrrol-2-yl)-2,2,2-trichloroethanone |
| PubChem CID | 2798140 |
| Molecular Formula | C6H3BrCl3NO |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 288.85 |
| IUPAC Name | 1-(4-bromo-1H-pyrrol-2-yl)-2,2,2-trichloroethanone |
| SMILES | O=C(c1cc(Br)c[nH]1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H3BrCl3NO/c7-3-1-4(11-2-3)5(12)6(8,9)10/h1-2,11H |
| InChIKey | CQLTVLIUJXOOGD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-bromo-1H-pyrrol-2-yl)-2,2,2-trichloroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromo-1H-pyrrol-2-yl)-2,2,2-trichloroethanone?
The IUPAC name of 1-(4-bromo-1H-pyrrol-2-yl)-2,2,2-trichloroethanone (CID 2798140) is 1-(4-bromo-1H-pyrrol-2-yl)-2,2,2-trichloroethanone.
What is the SMILES notation for 1-(4-bromo-1H-pyrrol-2-yl)-2,2,2-trichloroethanone?
The canonical SMILES for 1-(4-bromo-1H-pyrrol-2-yl)-2,2,2-trichloroethanone is O=C(c1cc(Br)c[nH]1)C(Cl)(Cl)Cl.
What is the InChIKey of 1-(4-bromo-1H-pyrrol-2-yl)-2,2,2-trichloroethanone?
The InChIKey is CQLTVLIUJXOOGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3BrCl3NO/c7-3-1-4(11-2-3)5(12)6(8,9)10/h1-2,11H.
What are the key properties of 1-(4-bromo-1H-pyrrol-2-yl)-2,2,2-trichloroethanone?
1-(4-bromo-1H-pyrrol-2-yl)-2,2,2-trichloroethanone has a molecular weight of 291.36 g/mol, XLogP of 3.33, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromo-1H-pyrrol-2-yl)-2,2,2-trichloroethanone is sourced from PubChem (CID 2798140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).