C14H19F2N3OS — CID 2798235
1-[1-(3,5-difluoro-2-hydroxyphenyl)ethylideneamino]-3-(2,2-dimethylpropyl)thiourea (PubChem CID 2798235) has the molecular formula C14H19F2N3OS and a molecular weight of 315.39 g/mol. Its IUPAC name is 1-[1-(3,5-difluoro-2-hydroxyphenyl)ethylideneamino]-3-(2,2-dimethylpropyl)thiourea.
| Compound Name | 1-[1-(3,5-difluoro-2-hydroxyphenyl)ethylideneamino]-3-(2,2-dimethylpropyl)thiourea |
|---|---|
| PubChem CID | 2798235 |
| Molecular Formula | C14H19F2N3OS |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 1-[1-(3,5-difluoro-2-hydroxyphenyl)ethylideneamino]-3-(2,2-dimethylpropyl)thiourea |
| SMILES | CC(=NNC(=S)NCC(C)(C)C)c1cc(F)cc(F)c1O |
| InChI | InChI=1S/C14H19F2N3OS/c1-8(10-5-9(15)6-11(16)12(10)20)18-19-13(21)17-7-14(2,3)4/h5-6,20H,7H2,1-4H3,(H2,17,19,21) |
| InChIKey | AMAGDRKSRLIMBF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|