About 4-(4,5-dihydro-1H-imidazol-2-yl)-2,6-dimethylmorpholine
4-(4,5-dihydro-1H-imidazol-2-yl)-2,6-dimethylmorpholine (PubChem CID 2798365) has the molecular formula C9H17N3O
and a molecular weight of 183.25 g/mol. Its IUPAC name is 4-(4,5-dihydro-1H-imidazol-2-yl)-2,6-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-(4,5-dihydro-1H-imidazol-2-yl)-2,6-dimethylmorpholine |
| PubChem CID | 2798365 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 4-(4,5-dihydro-1H-imidazol-2-yl)-2,6-dimethylmorpholine |
| SMILES | CC1CN(C2=NCCN2)CC(C)O1 |
| InChI | InChI=1S/C9H17N3O/c1-7-5-12(6-8(2)13-7)9-10-3-4-11-9/h7-8H,3-6H2,1-2H3,(H,10,11) |
| InChIKey | SPHOJUFJKJJFIR-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4,5-dihydro-1H-imidazol-2-yl)-2,6-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-dihydro-1H-imidazol-2-yl)-2,6-dimethylmorpholine?
The IUPAC name of 4-(4,5-dihydro-1H-imidazol-2-yl)-2,6-dimethylmorpholine (CID 2798365) is 4-(4,5-dihydro-1H-imidazol-2-yl)-2,6-dimethylmorpholine.
What is the SMILES notation for 4-(4,5-dihydro-1H-imidazol-2-yl)-2,6-dimethylmorpholine?
The canonical SMILES for 4-(4,5-dihydro-1H-imidazol-2-yl)-2,6-dimethylmorpholine is CC1CN(C2=NCCN2)CC(C)O1.
What is the InChIKey of 4-(4,5-dihydro-1H-imidazol-2-yl)-2,6-dimethylmorpholine?
The InChIKey is SPHOJUFJKJJFIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O/c1-7-5-12(6-8(2)13-7)9-10-3-4-11-9/h7-8H,3-6H2,1-2H3,(H,10,11).
What are the key properties of 4-(4,5-dihydro-1H-imidazol-2-yl)-2,6-dimethylmorpholine?
4-(4,5-dihydro-1H-imidazol-2-yl)-2,6-dimethylmorpholine has a molecular weight of 183.25 g/mol, XLogP of 0.05, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-dihydro-1H-imidazol-2-yl)-2,6-dimethylmorpholine is sourced from PubChem (CID 2798365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).