C18H14N4O3S — CID 2798442
5-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-3-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,2,4-oxadiazole (PubChem CID 2798442) has the molecular formula C18H14N4O3S and a molecular weight of 366.40 g/mol. Its IUPAC name is 5-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-3-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,2,4-oxadiazole.
| Compound Name | 5-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-3-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 2798442 |
| Molecular Formula | C18H14N4O3S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 5-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-3-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,2,4-oxadiazole |
| SMILES | Cc1onc(-c2ccccc2)c1-c1nc(CSc2cccc[n+]2[O-])no1 |
| InChI | InChI=1S/C18H14N4O3S/c1-12-16(17(21-24-12)13-7-3-2-4-8-13)18-19-14(20-25-18)11-26-15-9-5-6-10-22(15)23/h2-10H,11H2,1H3 |
| InChIKey | VCTKARMMKDFQLX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 91.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|