C10H3F6N5O4S — CID 2798515
3-[2,6-dinitro-4-(trifluoromethyl)phenyl]sulfanyl-5-(trifluoromethyl)-1H-1,2,4-triazole (PubChem CID 2798515) has the molecular formula C10H3F6N5O4S and a molecular weight of 403.22 g/mol. Its IUPAC name is 3-[2,6-dinitro-4-(trifluoromethyl)phenyl]sulfanyl-5-(trifluoromethyl)-1H-1,2,4-triazole.
| Compound Name | 3-[2,6-dinitro-4-(trifluoromethyl)phenyl]sulfanyl-5-(trifluoromethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 2798515 |
| Molecular Formula | C10H3F6N5O4S |
| Molecular Weight | 403.22 g/mol |
| Exact Mass | 402.98 |
| IUPAC Name | 3-[2,6-dinitro-4-(trifluoromethyl)phenyl]sulfanyl-5-(trifluoromethyl)-1H-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1Sc1n[nH]c(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H3F6N5O4S/c11-9(12,13)3-1-4(20(22)23)6(5(2-3)21(24)25)26-8-17-7(18-19-8)10(14,15)16/h1-2H,(H,17,18,19) |
| InChIKey | VMGMYZKRAXHYGD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.22 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|