C22H22Cl2N2S — CID 2798644
2-(2,6-dichloro-4-pyridinyl)-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazole (PubChem CID 2798644) has the molecular formula C22H22Cl2N2S and a molecular weight of 417.41 g/mol. Its IUPAC name is 2-(2,6-dichloro-4-pyridinyl)-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazole.
| Compound Name | 2-(2,6-dichloro-4-pyridinyl)-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 2798644 |
| Molecular Formula | C22H22Cl2N2S |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 2-(2,6-dichloro-4-pyridinyl)-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazole |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3csc(-c4cc(Cl)nc(Cl)c4)n3)ccc21 |
| InChI | InChI=1S/C22H22Cl2N2S/c1-21(2)7-8-22(3,4)16-9-13(5-6-15(16)21)17-12-27-20(25-17)14-10-18(23)26-19(24)11-14/h5-6,9-12H,7-8H2,1-4H3 |
| InChIKey | WQLLHTCEFBXCQG-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|