About 7-chloroindeno[1,2-b]quinoxalin-11-one
7-chloroindeno[1,2-b]quinoxalin-11-one (PubChem CID 2799068) has the molecular formula C15H7ClN2O
and a molecular weight of 266.69 g/mol. Its IUPAC name is 7-chloroindeno[1,2-b]quinoxalin-11-one.
Molecular Properties
| Compound Name | 7-chloroindeno[1,2-b]quinoxalin-11-one |
| PubChem CID | 2799068 |
| Molecular Formula | C15H7ClN2O |
| Molecular Weight | 266.69 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | 7-chloroindeno[1,2-b]quinoxalin-11-one |
| SMILES | O=C1c2ccccc2-c2nc3cc(Cl)ccc3nc21 |
| InChI | InChI=1S/C15H7ClN2O/c16-8-5-6-11-12(7-8)18-13-9-3-1-2-4-10(9)15(19)14(13)17-11/h1-7H |
| InChIKey | HEUXDKPPSDGYCV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.69 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-chloroindeno[1,2-b]quinoxalin-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloroindeno[1,2-b]quinoxalin-11-one?
The IUPAC name of 7-chloroindeno[1,2-b]quinoxalin-11-one (CID 2799068) is 7-chloroindeno[1,2-b]quinoxalin-11-one.
What is the SMILES notation for 7-chloroindeno[1,2-b]quinoxalin-11-one?
The canonical SMILES for 7-chloroindeno[1,2-b]quinoxalin-11-one is O=C1c2ccccc2-c2nc3cc(Cl)ccc3nc21.
What is the InChIKey of 7-chloroindeno[1,2-b]quinoxalin-11-one?
The InChIKey is HEUXDKPPSDGYCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H7ClN2O/c16-8-5-6-11-12(7-8)18-13-9-3-1-2-4-10(9)15(19)14(13)17-11/h1-7H.
What are the key properties of 7-chloroindeno[1,2-b]quinoxalin-11-one?
7-chloroindeno[1,2-b]quinoxalin-11-one has a molecular weight of 266.69 g/mol, XLogP of 3.49, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloroindeno[1,2-b]quinoxalin-11-one is sourced from PubChem (CID 2799068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).