About thiophen-2-ylmethylurea
thiophen-2-ylmethylurea (PubChem CID 2799110) has the molecular formula C6H8N2OS
and a molecular weight of 156.21 g/mol. Its IUPAC name is thiophen-2-ylmethylurea.
Molecular Properties
| Compound Name | thiophen-2-ylmethylurea |
| PubChem CID | 2799110 |
| Molecular Formula | C6H8N2OS |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | thiophen-2-ylmethylurea |
| SMILES | NC(=O)NCc1cccs1 |
| InChI | InChI=1S/C6H8N2OS/c7-6(9)8-4-5-2-1-3-10-5/h1-3H,4H2,(H3,7,8,9) |
| InChIKey | DBPGMIBBYIGDII-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze thiophen-2-ylmethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophen-2-ylmethylurea?
The IUPAC name of thiophen-2-ylmethylurea (CID 2799110) is thiophen-2-ylmethylurea.
What is the SMILES notation for thiophen-2-ylmethylurea?
The canonical SMILES for thiophen-2-ylmethylurea is NC(=O)NCc1cccs1.
What is the InChIKey of thiophen-2-ylmethylurea?
The InChIKey is DBPGMIBBYIGDII-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2OS/c7-6(9)8-4-5-2-1-3-10-5/h1-3H,4H2,(H3,7,8,9).
What are the key properties of thiophen-2-ylmethylurea?
thiophen-2-ylmethylurea has a molecular weight of 156.21 g/mol, XLogP of 0.92, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for thiophen-2-ylmethylurea is sourced from PubChem (CID 2799110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).