About N-(cyclopropylmethyl)-2,4-difluorobenzenesulfonamide
N-(cyclopropylmethyl)-2,4-difluorobenzenesulfonamide (PubChem CID 2799390) has the molecular formula C10H11F2NO2S
and a molecular weight of 247.27 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2,4-difluorobenzenesulfonamide.
Molecular Properties
| Compound Name | N-(cyclopropylmethyl)-2,4-difluorobenzenesulfonamide |
| PubChem CID | 2799390 |
| Molecular Formula | C10H11F2NO2S |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | N-(cyclopropylmethyl)-2,4-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCC1CC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C10H11F2NO2S/c11-8-3-4-10(9(12)5-8)16(14,15)13-6-7-1-2-7/h3-5,7,13H,1-2,6H2 |
| InChIKey | GWXJVQJJOBDPMG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(cyclopropylmethyl)-2,4-difluorobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclopropylmethyl)-2,4-difluorobenzenesulfonamide?
The IUPAC name of N-(cyclopropylmethyl)-2,4-difluorobenzenesulfonamide (CID 2799390) is N-(cyclopropylmethyl)-2,4-difluorobenzenesulfonamide.
What is the SMILES notation for N-(cyclopropylmethyl)-2,4-difluorobenzenesulfonamide?
The canonical SMILES for N-(cyclopropylmethyl)-2,4-difluorobenzenesulfonamide is O=S(=O)(NCC1CC1)c1ccc(F)cc1F.
What is the InChIKey of N-(cyclopropylmethyl)-2,4-difluorobenzenesulfonamide?
The InChIKey is GWXJVQJJOBDPMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2NO2S/c11-8-3-4-10(9(12)5-8)16(14,15)13-6-7-1-2-7/h3-5,7,13H,1-2,6H2.
What are the key properties of N-(cyclopropylmethyl)-2,4-difluorobenzenesulfonamide?
N-(cyclopropylmethyl)-2,4-difluorobenzenesulfonamide has a molecular weight of 247.27 g/mol, XLogP of 1.65, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclopropylmethyl)-2,4-difluorobenzenesulfonamide is sourced from PubChem (CID 2799390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).