About 1,5-bis(3,4-dichlorophenyl)tetrazole
1,5-bis(3,4-dichlorophenyl)tetrazole (PubChem CID 2799589) has the molecular formula C13H6Cl4N4
and a molecular weight of 360.03 g/mol. Its IUPAC name is 1,5-bis(3,4-dichlorophenyl)tetrazole.
Molecular Properties
| Compound Name | 1,5-bis(3,4-dichlorophenyl)tetrazole |
| PubChem CID | 2799589 |
| Molecular Formula | C13H6Cl4N4 |
| Molecular Weight | 360.03 g/mol |
| Exact Mass | 357.93 |
| IUPAC Name | 1,5-bis(3,4-dichlorophenyl)tetrazole |
| SMILES | Clc1ccc(-c2nnnn2-c2ccc(Cl)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C13H6Cl4N4/c14-9-3-1-7(5-11(9)16)13-18-19-20-21(13)8-2-4-10(15)12(17)6-8/h1-6H |
| InChIKey | YXHPXFQFVVHCME-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.03 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,5-bis(3,4-dichlorophenyl)tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-bis(3,4-dichlorophenyl)tetrazole?
The IUPAC name of 1,5-bis(3,4-dichlorophenyl)tetrazole (CID 2799589) is 1,5-bis(3,4-dichlorophenyl)tetrazole.
What is the SMILES notation for 1,5-bis(3,4-dichlorophenyl)tetrazole?
The canonical SMILES for 1,5-bis(3,4-dichlorophenyl)tetrazole is Clc1ccc(-c2nnnn2-c2ccc(Cl)c(Cl)c2)cc1Cl.
What is the InChIKey of 1,5-bis(3,4-dichlorophenyl)tetrazole?
The InChIKey is YXHPXFQFVVHCME-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6Cl4N4/c14-9-3-1-7(5-11(9)16)13-18-19-20-21(13)8-2-4-10(15)12(17)6-8/h1-6H.
What are the key properties of 1,5-bis(3,4-dichlorophenyl)tetrazole?
1,5-bis(3,4-dichlorophenyl)tetrazole has a molecular weight of 360.03 g/mol, XLogP of 4.94, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-bis(3,4-dichlorophenyl)tetrazole is sourced from PubChem (CID 2799589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).