About 1-benzyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one
1-benzyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one (PubChem CID 2799884) has the molecular formula C15H13NO3S
and a molecular weight of 287.34 g/mol. Its IUPAC name is 1-benzyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one.
Molecular Properties
| Compound Name | 1-benzyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one |
| PubChem CID | 2799884 |
| Molecular Formula | C15H13NO3S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 1-benzyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one |
| SMILES | O=C1CS(=O)(=O)N(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C15H13NO3S/c17-15-11-20(18,19)16(10-12-6-2-1-3-7-12)14-9-5-4-8-13(14)15/h1-9H,10-11H2 |
| InChIKey | PMVMITAPYZEZEW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one?
The IUPAC name of 1-benzyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one (CID 2799884) is 1-benzyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one.
What is the SMILES notation for 1-benzyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one?
The canonical SMILES for 1-benzyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one is O=C1CS(=O)(=O)N(Cc2ccccc2)c2ccccc21.
What is the InChIKey of 1-benzyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one?
The InChIKey is PMVMITAPYZEZEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO3S/c17-15-11-20(18,19)16(10-12-6-2-1-3-7-12)14-9-5-4-8-13(14)15/h1-9H,10-11H2.
What are the key properties of 1-benzyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one?
1-benzyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one has a molecular weight of 287.34 g/mol, XLogP of 2.22, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one is sourced from PubChem (CID 2799884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).