About (5-chloro-3-pyridinyl) 1-benzothiophene-2-carboxylate
(5-chloro-3-pyridinyl) 1-benzothiophene-2-carboxylate (PubChem CID 2800273) has the molecular formula C14H8ClNO2S
and a molecular weight of 289.74 g/mol. Its IUPAC name is (5-chloro-3-pyridinyl) 1-benzothiophene-2-carboxylate.
Molecular Properties
| Compound Name | (5-chloro-3-pyridinyl) 1-benzothiophene-2-carboxylate |
| PubChem CID | 2800273 |
| Molecular Formula | C14H8ClNO2S |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | (5-chloro-3-pyridinyl) 1-benzothiophene-2-carboxylate |
| SMILES | O=C(Oc1cncc(Cl)c1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C14H8ClNO2S/c15-10-6-11(8-16-7-10)18-14(17)13-5-9-3-1-2-4-12(9)19-13/h1-8H |
| InChIKey | MNUHXGJUYTWVLU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-chloro-3-pyridinyl) 1-benzothiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-3-pyridinyl) 1-benzothiophene-2-carboxylate?
The IUPAC name of (5-chloro-3-pyridinyl) 1-benzothiophene-2-carboxylate (CID 2800273) is (5-chloro-3-pyridinyl) 1-benzothiophene-2-carboxylate.
What is the SMILES notation for (5-chloro-3-pyridinyl) 1-benzothiophene-2-carboxylate?
The canonical SMILES for (5-chloro-3-pyridinyl) 1-benzothiophene-2-carboxylate is O=C(Oc1cncc(Cl)c1)c1cc2ccccc2s1.
What is the InChIKey of (5-chloro-3-pyridinyl) 1-benzothiophene-2-carboxylate?
The InChIKey is MNUHXGJUYTWVLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8ClNO2S/c15-10-6-11(8-16-7-10)18-14(17)13-5-9-3-1-2-4-12(9)19-13/h1-8H.
What are the key properties of (5-chloro-3-pyridinyl) 1-benzothiophene-2-carboxylate?
(5-chloro-3-pyridinyl) 1-benzothiophene-2-carboxylate has a molecular weight of 289.74 g/mol, XLogP of 4.17, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-3-pyridinyl) 1-benzothiophene-2-carboxylate is sourced from PubChem (CID 2800273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).