C12H11F3N6O2S — CID 2800651
N,N-dimethyl-N'-[3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazol-5-yl]methanimidamide (PubChem CID 2800651) has the molecular formula C12H11F3N6O2S and a molecular weight of 360.32 g/mol. Its IUPAC name is N,N-dimethyl-N'-[3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazol-5-yl]methanimidamide.
| Compound Name | N,N-dimethyl-N'-[3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazol-5-yl]methanimidamide |
|---|---|
| PubChem CID | 2800651 |
| Molecular Formula | C12H11F3N6O2S |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | N,N-dimethyl-N'-[3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazol-5-yl]methanimidamide |
| SMILES | CN(C)C=Nc1nc(Sc2ccc(C(F)(F)F)cc2[N+](=O)[O-])n[nH]1 |
| InChI | InChI=1S/C12H11F3N6O2S/c1-20(2)6-16-10-17-11(19-18-10)24-9-4-3-7(12(13,14)15)5-8(9)21(22)23/h3-6H,1-2H3,(H,17,18,19) |
| InChIKey | JFDYZSOIOOLMNI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 100.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|