C15H12F2N2O2 — CID 2800710
N-[2-(2,4-difluorophenoxy)-3-pyridinyl]-2-methylprop-2-enamide (PubChem CID 2800710) has the molecular formula C15H12F2N2O2 and a molecular weight of 290.27 g/mol. Its IUPAC name is N-[2-(2,4-difluorophenoxy)-3-pyridinyl]-2-methylprop-2-enamide.
| Compound Name | N-[2-(2,4-difluorophenoxy)-3-pyridinyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 2800710 |
| Molecular Formula | C15H12F2N2O2 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | N-[2-(2,4-difluorophenoxy)-3-pyridinyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)Nc1cccnc1Oc1ccc(F)cc1F |
| InChI | InChI=1S/C15H12F2N2O2/c1-9(2)14(20)19-12-4-3-7-18-15(12)21-13-6-5-10(16)8-11(13)17/h3-8H,1H2,2H3,(H,19,20) |
| InChIKey | OMMFNRHRJQFGAQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|