C16H18N4O2S — CID 2800798
3-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-1-methyl-5-phenylimidazolidine-2,4-dione (PubChem CID 2800798) has the molecular formula C16H18N4O2S and a molecular weight of 330.41 g/mol. Its IUPAC name is 3-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-1-methyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | 3-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-1-methyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2800798 |
| Molecular Formula | C16H18N4O2S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 3-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-1-methyl-5-phenylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)N(c2nnc(C(C)(C)C)s2)C(=O)C1c1ccccc1 |
| InChI | InChI=1S/C16H18N4O2S/c1-16(2,3)13-17-18-14(23-13)20-12(21)11(19(4)15(20)22)10-8-6-5-7-9-10/h5-9,11H,1-4H3 |
| InChIKey | LDUZEERSZDZCMD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|