About 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3,4-dichlorobenzoate
2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3,4-dichlorobenzoate (PubChem CID 2800999) has the molecular formula C15H10Cl2F3NO4S
and a molecular weight of 428.22 g/mol. Its IUPAC name is 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3,4-dichlorobenzoate.
Molecular Properties
| Compound Name | 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3,4-dichlorobenzoate |
| PubChem CID | 2800999 |
| Molecular Formula | C15H10Cl2F3NO4S |
| Molecular Weight | 428.22 g/mol |
| Exact Mass | 426.97 |
| IUPAC Name | 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3,4-dichlorobenzoate |
| SMILES | O=C(OCCS(=O)(=O)c1ccc(C(F)(F)F)cn1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H10Cl2F3NO4S/c16-11-3-1-9(7-12(11)17)14(22)25-5-6-26(23,24)13-4-2-10(8-21-13)15(18,19)20/h1-4,7-8H,5-6H2 |
| InChIKey | SZFNLPLTKSBJFL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.22 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3,4-dichlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3,4-dichlorobenzoate?
The IUPAC name of 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3,4-dichlorobenzoate (CID 2800999) is 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3,4-dichlorobenzoate.
What is the SMILES notation for 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3,4-dichlorobenzoate?
The canonical SMILES for 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3,4-dichlorobenzoate is O=C(OCCS(=O)(=O)c1ccc(C(F)(F)F)cn1)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3,4-dichlorobenzoate?
The InChIKey is SZFNLPLTKSBJFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10Cl2F3NO4S/c16-11-3-1-9(7-12(11)17)14(22)25-5-6-26(23,24)13-4-2-10(8-21-13)15(18,19)20/h1-4,7-8H,5-6H2.
What are the key properties of 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3,4-dichlorobenzoate?
2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3,4-dichlorobenzoate has a molecular weight of 428.22 g/mol, XLogP of 4.04, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3,4-dichlorobenzoate is sourced from PubChem (CID 2800999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).