About 2-[[3-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3-chlorobenzoate
2-[[3-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3-chlorobenzoate (PubChem CID 2801162) has the molecular formula C15H11ClF3NO4S
and a molecular weight of 393.77 g/mol. Its IUPAC name is 2-[[3-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3-chlorobenzoate.
Molecular Properties
| Compound Name | 2-[[3-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3-chlorobenzoate |
| PubChem CID | 2801162 |
| Molecular Formula | C15H11ClF3NO4S |
| Molecular Weight | 393.77 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | 2-[[3-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3-chlorobenzoate |
| SMILES | O=C(OCCS(=O)(=O)c1ncccc1C(F)(F)F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H11ClF3NO4S/c16-11-4-1-3-10(9-11)14(21)24-7-8-25(22,23)13-12(15(17,18)19)5-2-6-20-13/h1-6,9H,7-8H2 |
| InChIKey | OKQSPCNNIBTMLL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.77 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[3-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3-chlorobenzoate?
The IUPAC name of 2-[[3-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3-chlorobenzoate (CID 2801162) is 2-[[3-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3-chlorobenzoate.
What is the SMILES notation for 2-[[3-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3-chlorobenzoate?
The canonical SMILES for 2-[[3-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3-chlorobenzoate is O=C(OCCS(=O)(=O)c1ncccc1C(F)(F)F)c1cccc(Cl)c1.
What is the InChIKey of 2-[[3-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3-chlorobenzoate?
The InChIKey is OKQSPCNNIBTMLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11ClF3NO4S/c16-11-4-1-3-10(9-11)14(21)24-7-8-25(22,23)13-12(15(17,18)19)5-2-6-20-13/h1-6,9H,7-8H2.
What are the key properties of 2-[[3-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3-chlorobenzoate?
2-[[3-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3-chlorobenzoate has a molecular weight of 393.77 g/mol, XLogP of 3.38, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-(trifluoromethyl)-2-pyridinyl]sulfonyl]ethyl 3-chlorobenzoate is sourced from PubChem (CID 2801162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).