About 1,3-dipropylthiourea
1,3-dipropylthiourea (PubChem CID 2801214) has the molecular formula C7H16N2S
and a molecular weight of 160.29 g/mol. Its IUPAC name is 1,3-dipropylthiourea.
Molecular Properties
| Compound Name | 1,3-dipropylthiourea |
| PubChem CID | 2801214 |
| Molecular Formula | C7H16N2S |
| Molecular Weight | 160.29 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 1,3-dipropylthiourea |
| SMILES | CCCNC(=S)NCCC |
| InChI | InChI=1S/C7H16N2S/c1-3-5-8-7(10)9-6-4-2/h3-6H2,1-2H3,(H2,8,9,10) |
| InChIKey | AUXGIIVHLRLBSG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dipropylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dipropylthiourea?
The IUPAC name of 1,3-dipropylthiourea (CID 2801214) is 1,3-dipropylthiourea.
What is the SMILES notation for 1,3-dipropylthiourea?
The canonical SMILES for 1,3-dipropylthiourea is CCCNC(=S)NCCC.
What is the InChIKey of 1,3-dipropylthiourea?
The InChIKey is AUXGIIVHLRLBSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2S/c1-3-5-8-7(10)9-6-4-2/h3-6H2,1-2H3,(H2,8,9,10).
What are the key properties of 1,3-dipropylthiourea?
1,3-dipropylthiourea has a molecular weight of 160.29 g/mol, XLogP of 1.27, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dipropylthiourea is sourced from PubChem (CID 2801214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).