About 6-methyl-5-(2-methyl-1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenoxy]pyridine-3-carbonitrile
6-methyl-5-(2-methyl-1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenoxy]pyridine-3-carbonitrile (PubChem CID 2801264) has the molecular formula C18H12F3N3OS
and a molecular weight of 375.38 g/mol. Its IUPAC name is 6-methyl-5-(2-methyl-1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenoxy]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-methyl-5-(2-methyl-1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenoxy]pyridine-3-carbonitrile |
| PubChem CID | 2801264 |
| Molecular Formula | C18H12F3N3OS |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 6-methyl-5-(2-methyl-1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenoxy]pyridine-3-carbonitrile |
| SMILES | Cc1nc(-c2cc(C#N)c(Oc3ccc(C(F)(F)F)cc3)nc2C)cs1 |
| InChI | InChI=1S/C18H12F3N3OS/c1-10-15(16-9-26-11(2)24-16)7-12(8-22)17(23-10)25-14-5-3-13(4-6-14)18(19,20)21/h3-7,9H,1-2H3 |
| InChIKey | PXZHTBYUAODMKT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 58.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-methyl-5-(2-methyl-1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenoxy]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-5-(2-methyl-1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenoxy]pyridine-3-carbonitrile?
The IUPAC name of 6-methyl-5-(2-methyl-1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenoxy]pyridine-3-carbonitrile (CID 2801264) is 6-methyl-5-(2-methyl-1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenoxy]pyridine-3-carbonitrile.
What is the SMILES notation for 6-methyl-5-(2-methyl-1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenoxy]pyridine-3-carbonitrile?
The canonical SMILES for 6-methyl-5-(2-methyl-1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenoxy]pyridine-3-carbonitrile is Cc1nc(-c2cc(C#N)c(Oc3ccc(C(F)(F)F)cc3)nc2C)cs1.
What is the InChIKey of 6-methyl-5-(2-methyl-1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenoxy]pyridine-3-carbonitrile?
The InChIKey is PXZHTBYUAODMKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12F3N3OS/c1-10-15(16-9-26-11(2)24-16)7-12(8-22)17(23-10)25-14-5-3-13(4-6-14)18(19,20)21/h3-7,9H,1-2H3.
What are the key properties of 6-methyl-5-(2-methyl-1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenoxy]pyridine-3-carbonitrile?
6-methyl-5-(2-methyl-1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenoxy]pyridine-3-carbonitrile has a molecular weight of 375.38 g/mol, XLogP of 5.50, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-5-(2-methyl-1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenoxy]pyridine-3-carbonitrile is sourced from PubChem (CID 2801264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).