About 4-bromo-2-ethylaniline
4-bromo-2-ethylaniline (PubChem CID 2801283) has the molecular formula C8H10BrN
and a molecular weight of 200.08 g/mol. Its IUPAC name is 4-bromo-2-ethylaniline.
Molecular Properties
| Compound Name | 4-bromo-2-ethylaniline |
| PubChem CID | 2801283 |
| Molecular Formula | C8H10BrN |
| Molecular Weight | 200.08 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | 4-bromo-2-ethylaniline |
| SMILES | CCc1cc(Br)ccc1N |
| InChI | InChI=1S/C8H10BrN/c1-2-6-5-7(9)3-4-8(6)10/h3-5H,2,10H2,1H3 |
| InChIKey | LGOZNQPHTIGMQJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.08 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2-ethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-ethylaniline?
The IUPAC name of 4-bromo-2-ethylaniline (CID 2801283) is 4-bromo-2-ethylaniline.
What is the SMILES notation for 4-bromo-2-ethylaniline?
The canonical SMILES for 4-bromo-2-ethylaniline is CCc1cc(Br)ccc1N.
What is the InChIKey of 4-bromo-2-ethylaniline?
The InChIKey is LGOZNQPHTIGMQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BrN/c1-2-6-5-7(9)3-4-8(6)10/h3-5H,2,10H2,1H3.
What are the key properties of 4-bromo-2-ethylaniline?
4-bromo-2-ethylaniline has a molecular weight of 200.08 g/mol, XLogP of 2.59, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-ethylaniline is sourced from PubChem (CID 2801283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).