About 2,3-dihydro-1,4-benzodioxine-6-carbonitrile
2,3-dihydro-1,4-benzodioxine-6-carbonitrile (PubChem CID 2801439) has the molecular formula C9H7NO2
and a molecular weight of 161.16 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxine-6-carbonitrile.
Molecular Properties
| Compound Name | 2,3-dihydro-1,4-benzodioxine-6-carbonitrile |
| PubChem CID | 2801439 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxine-6-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C9H7NO2/c10-6-7-1-2-8-9(5-7)12-4-3-11-8/h1-2,5H,3-4H2 |
| InChIKey | JGSRMKGBXNXODT-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydro-1,4-benzodioxine-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1,4-benzodioxine-6-carbonitrile?
The IUPAC name of 2,3-dihydro-1,4-benzodioxine-6-carbonitrile (CID 2801439) is 2,3-dihydro-1,4-benzodioxine-6-carbonitrile.
What is the SMILES notation for 2,3-dihydro-1,4-benzodioxine-6-carbonitrile?
The canonical SMILES for 2,3-dihydro-1,4-benzodioxine-6-carbonitrile is N#Cc1ccc2c(c1)OCCO2.
What is the InChIKey of 2,3-dihydro-1,4-benzodioxine-6-carbonitrile?
The InChIKey is JGSRMKGBXNXODT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2/c10-6-7-1-2-8-9(5-7)12-4-3-11-8/h1-2,5H,3-4H2.
What are the key properties of 2,3-dihydro-1,4-benzodioxine-6-carbonitrile?
2,3-dihydro-1,4-benzodioxine-6-carbonitrile has a molecular weight of 161.16 g/mol, XLogP of 1.33, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1,4-benzodioxine-6-carbonitrile is sourced from PubChem (CID 2801439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).